C11H16ClNO2 — CID 83937351
2-amino-1-(4-chloro-3-methylphenyl)butane-1,4-diol (PubChem CID 83937351) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-amino-1-(4-chloro-3-methylphenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(4-chloro-3-methylphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83937351 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-1-(4-chloro-3-methylphenyl)butane-1,4-diol |
| SMILES | Cc1cc(C(O)C(N)CCO)ccc1Cl |
| InChI | InChI=1S/C11H16ClNO2/c1-7-6-8(2-3-9(7)12)11(15)10(13)4-5-14/h2-3,6,10-11,14-15H,4-5,13H2,1H3 |
| InChIKey | DULQYKSWGIEEHR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |