C9H13ClN2 — CID 55274034
1-(4-chloro-3-methylphenyl)ethane-1,2-diamine (PubChem CID 55274034) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-chloro-3-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55274034 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(C(N)CN)ccc1Cl |
| InChI | InChI=1S/C9H13ClN2/c1-6-4-7(9(12)5-11)2-3-8(6)10/h2-4,9H,5,11-12H2,1H3 |
| InChIKey | FOBYUSYKPJDZCW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |