C12H17ClN2 — CID 175078061
2-(azetidin-1-yl)-1-(4-chloro-3-methylphenyl)ethanamine (PubChem CID 175078061) has the molecular formula C12H17ClN2 and a molecular weight of 224.74 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-1-(4-chloro-3-methylphenyl)ethanamine.
| Compound Name | 2-(azetidin-1-yl)-1-(4-chloro-3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 175078061 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(azetidin-1-yl)-1-(4-chloro-3-methylphenyl)ethanamine |
| SMILES | Cc1cc(C(N)CN2CCC2)ccc1Cl |
| InChI | InChI=1S/C12H17ClN2/c1-9-7-10(3-4-11(9)13)12(14)8-15-5-2-6-15/h3-4,7,12H,2,5-6,8,14H2,1H3 |
| InChIKey | CJFCIXVOUYHLPH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |