C14H23NO — CID 103922500
(2R)-2-[1-(3,4-dimethylphenyl)ethylamino]butan-1-ol (PubChem CID 103922500) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (2R)-2-[1-(3,4-dimethylphenyl)ethylamino]butan-1-ol.
| Compound Name | (2R)-2-[1-(3,4-dimethylphenyl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 103922500 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2R)-2-[1-(3,4-dimethylphenyl)ethylamino]butan-1-ol |
| SMILES | CC[C@H](CO)NC(C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H23NO/c1-5-14(9-16)15-12(4)13-7-6-10(2)11(3)8-13/h6-8,12,14-16H,5,9H2,1-4H3/t12?,14-/m1/s1 |
| InChIKey | LTQVXZNHHLYARS-TYZXPVIJSA-N |
| XLogP | 2.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |