C12H18ClNO — CID 28723516
(2S)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]butan-1-ol (PubChem CID 28723516) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]butan-1-ol.
| Compound Name | (2S)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 28723516 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2S)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]butan-1-ol |
| SMILES | CC[C@@H](CO)N[C@@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO/c1-3-12(8-15)14-9(2)10-4-6-11(13)7-5-10/h4-7,9,12,14-15H,3,8H2,1-2H3/t9-,12-/m0/s1 |
| InChIKey | QTNGUMZDJOJKGK-CABZTGNLSA-N |
| XLogP | 2.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |