C13H21NO3S — CID 103922580
(2R)-2-[1-(4-methylsulfonylphenyl)ethylamino]butan-1-ol (PubChem CID 103922580) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is (2R)-2-[1-(4-methylsulfonylphenyl)ethylamino]butan-1-ol.
| Compound Name | (2R)-2-[1-(4-methylsulfonylphenyl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 103922580 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2R)-2-[1-(4-methylsulfonylphenyl)ethylamino]butan-1-ol |
| SMILES | CC[C@H](CO)NC(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21NO3S/c1-4-12(9-15)14-10(2)11-5-7-13(8-6-11)18(3,16)17/h5-8,10,12,14-15H,4,9H2,1-3H3/t10?,12-/m1/s1 |
| InChIKey | MGLJCDZIKPGGOH-TVKKRMFBSA-N |
| XLogP | 1.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |