C13H20ClNS — CID 115899225
N-[1-(4-chlorophenyl)ethyl]-1-methylsulfanylbutan-2-amine (PubChem CID 115899225) has the molecular formula C13H20ClNS and a molecular weight of 257.83 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-1-methylsulfanylbutan-2-amine.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 115899225 |
| Molecular Formula | C13H20ClNS |
| Molecular Weight | 257.83 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-1-methylsulfanylbutan-2-amine |
| SMILES | CCC(CSC)NC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClNS/c1-4-13(9-16-3)15-10(2)11-5-7-12(14)8-6-11/h5-8,10,13,15H,4,9H2,1-3H3 |
| InChIKey | KZQMFGRLZLTLTG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |