C11H17NO — CID 93471271
(2R)-2-(3,4-dimethylphenyl)-2-(methylamino)ethanol (PubChem CID 93471271) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethylphenyl)-2-(methylamino)ethanol.
| Compound Name | (2R)-2-(3,4-dimethylphenyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 93471271 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2R)-2-(3,4-dimethylphenyl)-2-(methylamino)ethanol |
| SMILES | CN[C@@H](CO)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H17NO/c1-8-4-5-10(6-9(8)2)11(7-13)12-3/h4-6,11-13H,7H2,1-3H3/t11-/m0/s1 |
| InChIKey | KGPPRSOEKCNDJJ-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |