C11H18N+ — CID 7176018
[(1S)-1-(3,4-dimethylphenyl)propyl]azanium (PubChem CID 7176018) has the molecular formula C11H18N+ and a molecular weight of 164.27 g/mol. Its IUPAC name is [(1S)-1-(3,4-dimethylphenyl)propyl]azanium.
| Compound Name | [(1S)-1-(3,4-dimethylphenyl)propyl]azanium |
|---|---|
| PubChem CID | 7176018 |
| Molecular Formula | C11H18N+ |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | [(1S)-1-(3,4-dimethylphenyl)propyl]azanium |
| SMILES | CC[C@H]([NH3+])c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H17N/c1-4-11(12)10-6-5-8(2)9(3)7-10/h5-7,11H,4,12H2,1-3H3/p+1/t11-/m0/s1 |
| InChIKey | WCTLOIPMQALXLC-NSHDSACASA-O |
| XLogP | 2.00 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |