C13H22N+ — CID 59124075
[1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium (PubChem CID 59124075) has the molecular formula C13H22N+ and a molecular weight of 192.33 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium.
| Compound Name | [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium |
|---|---|
| PubChem CID | 59124075 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium |
| SMILES | Cc1ccc(C([NH3+])C(C)(C)C)cc1C |
| InChI | InChI=1S/C13H21N/c1-9-6-7-11(8-10(9)2)12(14)13(3,4)5/h6-8,12H,14H2,1-5H3/p+1 |
| InChIKey | FEFDOVBEDOJGKK-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |