About [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium
[1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium (PubChem CID 59124075) has the molecular formula C13H22N+
and a molecular weight of 192.33 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium.
Molecular Properties
| Compound Name | [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium |
| PubChem CID | 59124075 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium |
| SMILES | Cc1ccc(C([NH3+])C(C)(C)C)cc1C |
| InChI | InChI=1S/C13H21N/c1-9-6-7-11(8-10(9)2)12(14)13(3,4)5/h6-8,12H,14H2,1-5H3/p+1 |
| InChIKey | FEFDOVBEDOJGKK-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium?
The IUPAC name of [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium (CID 59124075) is [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium.
What is the SMILES notation for [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium?
The canonical SMILES for [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium is Cc1ccc(C([NH3+])C(C)(C)C)cc1C.
What is the InChIKey of [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium?
The InChIKey is FEFDOVBEDOJGKK-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H21N/c1-9-6-7-11(8-10(9)2)12(14)13(3,4)5/h6-8,12H,14H2,1-5H3/p+1.
What are the key properties of [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium?
[1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium has a molecular weight of 192.33 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dimethylphenyl)-2,2-dimethylpropyl]azanium is sourced from PubChem (CID 59124075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).