C11H19NS — CID 139523138
(2E)-N-ethyl-4-methylsulfanyl-N-prop-1-en-2-ylpenta-2,4-dien-2-amine (PubChem CID 139523138) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (2E)-N-ethyl-4-methylsulfanyl-N-prop-1-en-2-ylpenta-2,4-dien-2-amine.
| Compound Name | (2E)-N-ethyl-4-methylsulfanyl-N-prop-1-en-2-ylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 139523138 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2E)-N-ethyl-4-methylsulfanyl-N-prop-1-en-2-ylpenta-2,4-dien-2-amine |
| SMILES | C=C(/C=C(\C)N(CC)C(=C)C)SC |
| InChI | InChI=1S/C11H19NS/c1-7-12(9(2)3)10(4)8-11(5)13-6/h8H,2,5,7H2,1,3-4,6H3/b10-8+ |
| InChIKey | QIZSWPKSCNKRMF-CSKARUKUSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|