C10H16S — CID 143383124
(3E)-2,5-dimethyl-3-(methylsulfanylmethyl)hexa-1,3,5-triene (PubChem CID 143383124) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is (3E)-2,5-dimethyl-3-(methylsulfanylmethyl)hexa-1,3,5-triene.
| Compound Name | (3E)-2,5-dimethyl-3-(methylsulfanylmethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143383124 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (3E)-2,5-dimethyl-3-(methylsulfanylmethyl)hexa-1,3,5-triene |
| SMILES | C=C(C)/C=C(/CSC)C(=C)C |
| InChI | InChI=1S/C10H16S/c1-8(2)6-10(7-11-5)9(3)4/h6H,1,3,7H2,2,4-5H3/b10-6- |
| InChIKey | UKXKSAXYDNWQJL-POHAHGRESA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|