C16H25N — CID 170223795
(3E,5Z)-N,3,4,7-tetramethyl-5-(2-methylprop-2-enyl)octa-1,3,5,7-tetraen-2-amine (PubChem CID 170223795) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (3E,5Z)-N,3,4,7-tetramethyl-5-(2-methylprop-2-enyl)octa-1,3,5,7-tetraen-2-amine.
| Compound Name | (3E,5Z)-N,3,4,7-tetramethyl-5-(2-methylprop-2-enyl)octa-1,3,5,7-tetraen-2-amine |
|---|---|
| PubChem CID | 170223795 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (3E,5Z)-N,3,4,7-tetramethyl-5-(2-methylprop-2-enyl)octa-1,3,5,7-tetraen-2-amine |
| SMILES | C=C(C)/C=C(CC(=C)C)\C(C)=C(/C)C(=C)NC |
| InChI | InChI=1S/C16H25N/c1-11(2)9-16(10-12(3)4)14(6)13(5)15(7)17-8/h9,17H,1,3,7,10H2,2,4-6,8H3/b14-13+,16-9- |
| InChIKey | DNEWEUDBKKAOKB-CTXZKPBASA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|