C8H16N2 — CID 166992049
1-ethyl-2-methyl-1-[(1E)-3-methylbuta-1,3-dienyl]hydrazine (PubChem CID 166992049) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-ethyl-2-methyl-1-[(1E)-3-methylbuta-1,3-dienyl]hydrazine.
| Compound Name | 1-ethyl-2-methyl-1-[(1E)-3-methylbuta-1,3-dienyl]hydrazine |
|---|---|
| PubChem CID | 166992049 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-ethyl-2-methyl-1-[(1E)-3-methylbuta-1,3-dienyl]hydrazine |
| SMILES | C=C(C)/C=C/N(CC)NC |
| InChI | InChI=1S/C8H16N2/c1-5-10(9-4)7-6-8(2)3/h6-7,9H,2,5H2,1,3-4H3/b7-6+ |
| InChIKey | ZVEFOWPBXUZQAN-VOTSOKGWSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|