C11H19NO — CID 145069302
N-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-N-ethylhydroxylamine (PubChem CID 145069302) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-N-ethylhydroxylamine.
| Compound Name | N-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-N-ethylhydroxylamine |
|---|---|
| PubChem CID | 145069302 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-N-ethylhydroxylamine |
| SMILES | C=C(C)/C=C\C(=C(C)C)N(O)CC |
| InChI | InChI=1S/C11H19NO/c1-6-12(13)11(10(4)5)8-7-9(2)3/h7-8,13H,2,6H2,1,3-5H3/b8-7- |
| InChIKey | NZDOBWWOQMBAKH-FPLPWBNLSA-N |
| XLogP | 3.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|