About 4-ethylhexa-2,3-diene
4-ethylhexa-2,3-diene (PubChem CID 57110962) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is 4-ethylhexa-2,3-diene.
Molecular Properties
| Compound Name | 4-ethylhexa-2,3-diene |
| PubChem CID | 57110962 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | 4-ethylhexa-2,3-diene |
| SMILES | CC=C=C(CC)CC |
| InChI | InChI=1S/C8H14/c1-4-7-8(5-2)6-3/h4H,5-6H2,1-3H3 |
| InChIKey | CXCCFYQFNUDXQH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethylhexa-2,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylhexa-2,3-diene?
The IUPAC name of 4-ethylhexa-2,3-diene (CID 57110962) is 4-ethylhexa-2,3-diene.
What is the SMILES notation for 4-ethylhexa-2,3-diene?
The canonical SMILES for 4-ethylhexa-2,3-diene is CC=C=C(CC)CC.
What is the InChIKey of 4-ethylhexa-2,3-diene?
The InChIKey is CXCCFYQFNUDXQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14/c1-4-7-8(5-2)6-3/h4H,5-6H2,1-3H3.
What are the key properties of 4-ethylhexa-2,3-diene?
4-ethylhexa-2,3-diene has a molecular weight of 110.20 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylhexa-2,3-diene is sourced from PubChem (CID 57110962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).