C8H14 — CID 57110962
4-ethylhexa-2,3-diene (PubChem CID 57110962) has the molecular formula C8H14 and a molecular weight of 110.20 g/mol. Its IUPAC name is 4-ethylhexa-2,3-diene.
| Compound Name | 4-ethylhexa-2,3-diene |
|---|---|
| PubChem CID | 57110962 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | 4-ethylhexa-2,3-diene |
| SMILES | CC=C=C(CC)CC |
| InChI | InChI=1S/C8H14/c1-4-7-8(5-2)6-3/h4H,5-6H2,1-3H3 |
| InChIKey | CXCCFYQFNUDXQH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |