C12H18 — CID 173264693
4-ethyl-5-methylnona-2,3,5,7-tetraene (PubChem CID 173264693) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 4-ethyl-5-methylnona-2,3,5,7-tetraene.
| Compound Name | 4-ethyl-5-methylnona-2,3,5,7-tetraene |
|---|---|
| PubChem CID | 173264693 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 4-ethyl-5-methylnona-2,3,5,7-tetraene |
| SMILES | CC=C=C(CC)C(C)=CC=CC |
| InChI | InChI=1S/C12H18/c1-5-8-10-11(4)12(7-3)9-6-2/h5-6,8,10H,7H2,1-4H3 |
| InChIKey | YXDDZPQKBAWJJV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|