C12H18O — CID 143088479
(2E,4E,6Z,8E)-3,6-dimethyldeca-2,4,6,8-tetraen-4-ol (PubChem CID 143088479) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-3,6-dimethyldeca-2,4,6,8-tetraen-4-ol.
| Compound Name | (2E,4E,6Z,8E)-3,6-dimethyldeca-2,4,6,8-tetraen-4-ol |
|---|---|
| PubChem CID | 143088479 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (2E,4E,6Z,8E)-3,6-dimethyldeca-2,4,6,8-tetraen-4-ol |
| SMILES | C/C=C/C=C(C)\C=C(O)/C(C)=C/C |
| InChI | InChI=1S/C12H18O/c1-5-7-8-10(3)9-12(13)11(4)6-2/h5-9,13H,1-4H3/b7-5+,10-8-,11-6+,12-9+ |
| InChIKey | CGWLKTVZTSQSCT-VDDIPUTESA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|