C10H16O2S — CID 173385385
(4E,6Z)-3-methyl-4-methylsulfonylocta-2,4,6-triene (PubChem CID 173385385) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is (4E,6Z)-3-methyl-4-methylsulfonylocta-2,4,6-triene.
| Compound Name | (4E,6Z)-3-methyl-4-methylsulfonylocta-2,4,6-triene |
|---|---|
| PubChem CID | 173385385 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (4E,6Z)-3-methyl-4-methylsulfonylocta-2,4,6-triene |
| SMILES | CC=C(C)/C(=C\C=C/C)S(C)(=O)=O |
| InChI | InChI=1S/C10H16O2S/c1-5-7-8-10(9(3)6-2)13(4,11)12/h5-8H,1-4H3/b7-5-,9-6?,10-8+ |
| InChIKey | KMVNZFNRXWDCTA-CTFOTCHTSA-N |
| XLogP | 2.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|