C11H19NO2S — CID 139304214
(2E,4Z,6Z)-4-ethyl-N-methylocta-2,4,6-triene-3-sulfonamide (PubChem CID 139304214) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is (2E,4Z,6Z)-4-ethyl-N-methylocta-2,4,6-triene-3-sulfonamide.
| Compound Name | (2E,4Z,6Z)-4-ethyl-N-methylocta-2,4,6-triene-3-sulfonamide |
|---|---|
| PubChem CID | 139304214 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (2E,4Z,6Z)-4-ethyl-N-methylocta-2,4,6-triene-3-sulfonamide |
| SMILES | C/C=C\C=C(CC)/C(=C\C)S(=O)(=O)NC |
| InChI | InChI=1S/C11H19NO2S/c1-5-8-9-10(6-2)11(7-3)15(13,14)12-4/h5,7-9,12H,6H2,1-4H3/b8-5-,10-9-,11-7+ |
| InChIKey | IYTCBQYAHVHWCB-DORUCHGBSA-N |
| XLogP | 2.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|