C15H26O — CID 144690491
ethane;(2E,4E,6E,8Z)-6-ethyl-5-methyldeca-2,4,6,8-tetraen-2-ol (PubChem CID 144690491) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is ethane;(2E,4E,6E,8Z)-6-ethyl-5-methyldeca-2,4,6,8-tetraen-2-ol.
| Compound Name | ethane;(2E,4E,6E,8Z)-6-ethyl-5-methyldeca-2,4,6,8-tetraen-2-ol |
|---|---|
| PubChem CID | 144690491 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | ethane;(2E,4E,6E,8Z)-6-ethyl-5-methyldeca-2,4,6,8-tetraen-2-ol |
| SMILES | C/C=C\C=C(CC)\C(C)=C\C=C(/C)O.CC |
| InChI | InChI=1S/C13H20O.C2H6/c1-5-7-8-13(6-2)11(3)9-10-12(4)14;1-2/h5,7-10,14H,6H2,1-4H3;1-2H3/b7-5-,11-9+,12-10+,13-8+; |
| InChIKey | ISCOQMUAFKORSX-MPDUBJGESA-N |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|