C9H14O3 — CID 173280763
2-propylhexa-2,4-dieneperoxoic acid (PubChem CID 173280763) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-propylhexa-2,4-dieneperoxoic acid.
| Compound Name | 2-propylhexa-2,4-dieneperoxoic acid |
|---|---|
| PubChem CID | 173280763 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-propylhexa-2,4-dieneperoxoic acid |
| SMILES | CC=CC=C(CCC)C(=O)OO |
| InChI | InChI=1S/C9H14O3/c1-3-5-7-8(6-4-2)9(10)12-11/h3,5,7,11H,4,6H2,1-2H3 |
| InChIKey | LMRXMAYZKJMENJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|