2-propylhexa-2,4-dieneperoxoic acid

C9H14O3 — CID 173280763

IUPAC2-propylhexa-2,4-dieneperoxoic acid
SMILESCC=CC=C(CCC)C(=O)OO
InChIInChI=1S/C9H14O3/c1-3-5-7-8(6-4-2)9(10)12-11/h3,5,7,11H,4,6H2,1-2H3
InChIKeyLMRXMAYZKJMENJ-UHFFFAOYSA-N
MW170.21 g/mol
LogP2.31
Rot. Bonds4

About 2-propylhexa-2,4-dieneperoxoic acid

2-propylhexa-2,4-dieneperoxoic acid (PubChem CID 173280763) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-propylhexa-2,4-dieneperoxoic acid.

Molecular Properties

Compound Name2-propylhexa-2,4-dieneperoxoic acid
PubChem CID173280763
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Name2-propylhexa-2,4-dieneperoxoic acid
SMILESCC=CC=C(CCC)C(=O)OO
InChIInChI=1S/C9H14O3/c1-3-5-7-8(6-4-2)9(10)12-11/h3,5,7,11H,4,6H2,1-2H3
InChIKeyLMRXMAYZKJMENJ-UHFFFAOYSA-N
XLogP2.31
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-propylhexa-2,4-dieneperoxoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propylhexa-2,4-dieneperoxoic acid?
The IUPAC name of 2-propylhexa-2,4-dieneperoxoic acid (CID 173280763) is 2-propylhexa-2,4-dieneperoxoic acid.
What is the SMILES notation for 2-propylhexa-2,4-dieneperoxoic acid?
The canonical SMILES for 2-propylhexa-2,4-dieneperoxoic acid is CC=CC=C(CCC)C(=O)OO.
What is the InChIKey of 2-propylhexa-2,4-dieneperoxoic acid?
The InChIKey is LMRXMAYZKJMENJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-3-5-7-8(6-4-2)9(10)12-11/h3,5,7,11H,4,6H2,1-2H3.
What are the key properties of 2-propylhexa-2,4-dieneperoxoic acid?
2-propylhexa-2,4-dieneperoxoic acid has a molecular weight of 170.21 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylhexa-2,4-dieneperoxoic acid is sourced from PubChem (CID 173280763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).