C19H36O2Sn — CID 134940806
methyl (2Z,4Z)-2-tributylstannylhexa-2,4-dienoate (PubChem CID 134940806) has the molecular formula C19H36O2Sn and a molecular weight of 415.21 g/mol. Its IUPAC name is methyl (2Z,4Z)-2-tributylstannylhexa-2,4-dienoate.
| Compound Name | methyl (2Z,4Z)-2-tributylstannylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 134940806 |
| Molecular Formula | C19H36O2Sn |
| Molecular Weight | 415.21 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl (2Z,4Z)-2-tributylstannylhexa-2,4-dienoate |
| SMILES | C/C=C\C=C(\C(=O)OC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C7H9O2.3C4H9.Sn/c1-3-4-5-6-7(8)9-2;3*1-3-4-2;/h3-5H,1-2H3;3*1,3-4H2,2H3;/b4-3-,6-5?;;;; |
| InChIKey | RWQLMFQLMDQZPL-ZMTYPOMCSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.21 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|