C26H42O5Sn — CID 177449750
diethyl (2E,4Z)-2-(furan-2-yl)-5-tributylstannylhexa-2,4-dienedioate (PubChem CID 177449750) has the molecular formula C26H42O5Sn and a molecular weight of 553.33 g/mol. Its IUPAC name is diethyl (2E,4Z)-2-(furan-2-yl)-5-tributylstannylhexa-2,4-dienedioate.
| Compound Name | diethyl (2E,4Z)-2-(furan-2-yl)-5-tributylstannylhexa-2,4-dienedioate |
|---|---|
| PubChem CID | 177449750 |
| Molecular Formula | C26H42O5Sn |
| Molecular Weight | 553.33 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | diethyl (2E,4Z)-2-(furan-2-yl)-5-tributylstannylhexa-2,4-dienedioate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\C=C(\C(=O)OCC)c1ccco1)C(=O)OCC |
| InChI | InChI=1S/C14H15O5.3C4H9.Sn/c1-3-17-13(15)9-5-7-11(14(16)18-4-2)12-8-6-10-19-12;3*1-3-4-2;/h5-8,10H,3-4H2,1-2H3;3*1,3-4H2,2H3;/b9-5?,11-7+;;;; |
| InChIKey | AFHXXQXHPVUUKP-SYGDMISGSA-N |
| XLogP | 7.10 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.33 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|