About butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate
butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate (PubChem CID 102228107) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate.
Molecular Properties
| Compound Name | butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate |
| PubChem CID | 102228107 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate |
| SMILES | CCCCOC(=O)/C=C/C=C(\OC(=O)N(C)C)c1ccco1 |
| InChI | InChI=1S/C16H21NO5/c1-4-5-11-21-15(18)10-6-8-14(13-9-7-12-20-13)22-16(19)17(2)3/h6-10,12H,4-5,11H2,1-3H3/b10-6+,14-8- |
| InChIKey | GAAUTSDIXCEVPJ-UUIXNEETSA-N |
| XLogP | 3.22 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate?
The IUPAC name of butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate (CID 102228107) is butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate.
What is the SMILES notation for butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate?
The canonical SMILES for butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate is CCCCOC(=O)/C=C/C=C(\OC(=O)N(C)C)c1ccco1.
What is the InChIKey of butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate?
The InChIKey is GAAUTSDIXCEVPJ-UUIXNEETSA-N. The full InChI is InChI=1S/C16H21NO5/c1-4-5-11-21-15(18)10-6-8-14(13-9-7-12-20-13)22-16(19)17(2)3/h6-10,12H,4-5,11H2,1-3H3/b10-6+,14-8-.
What are the key properties of butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate?
butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate has a molecular weight of 307.35 g/mol, XLogP of 3.22, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate is sourced from PubChem (CID 102228107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).