C16H21NO5 — CID 102228107
butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate (PubChem CID 102228107) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate.
| Compound Name | butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 102228107 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | butyl (2E,4Z)-5-(dimethylcarbamoyloxy)-5-(furan-2-yl)penta-2,4-dienoate |
| SMILES | CCCCOC(=O)/C=C/C=C(\OC(=O)N(C)C)c1ccco1 |
| InChI | InChI=1S/C16H21NO5/c1-4-5-11-21-15(18)10-6-8-14(13-9-7-12-20-13)22-16(19)17(2)3/h6-10,12H,4-5,11H2,1-3H3/b10-6+,14-8- |
| InChIKey | GAAUTSDIXCEVPJ-UUIXNEETSA-N |
| XLogP | 3.22 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|