C21H33F3O4Sn — CID 171932379
dimethyl (Z)-2-tributylstannyl-3-(3,3,3-trifluoroprop-1-ynyl)but-2-enedioate (PubChem CID 171932379) has the molecular formula C21H33F3O4Sn and a molecular weight of 525.20 g/mol. Its IUPAC name is dimethyl (Z)-2-tributylstannyl-3-(3,3,3-trifluoroprop-1-ynyl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-tributylstannyl-3-(3,3,3-trifluoroprop-1-ynyl)but-2-enedioate |
|---|---|
| PubChem CID | 171932379 |
| Molecular Formula | C21H33F3O4Sn |
| Molecular Weight | 525.20 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | dimethyl (Z)-2-tributylstannyl-3-(3,3,3-trifluoroprop-1-ynyl)but-2-enedioate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C(=O)OC)=C(/C#CC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H6F3O4.3C4H9.Sn/c1-15-7(13)5-6(8(14)16-2)3-4-9(10,11)12;3*1-3-4-2;/h1-2H3;3*1,3-4H2,2H3; |
| InChIKey | VDGGMMIOFWKVAO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.20 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|