C21H35F3O2Sn — CID 177411770
ethyl (E)-6,6,6-trifluoro-3-methyl-2-tributylstannylhex-2-en-4-ynoate (PubChem CID 177411770) has the molecular formula C21H35F3O2Sn and a molecular weight of 495.21 g/mol. Its IUPAC name is ethyl (E)-6,6,6-trifluoro-3-methyl-2-tributylstannylhex-2-en-4-ynoate.
| Compound Name | ethyl (E)-6,6,6-trifluoro-3-methyl-2-tributylstannylhex-2-en-4-ynoate |
|---|---|
| PubChem CID | 177411770 |
| Molecular Formula | C21H35F3O2Sn |
| Molecular Weight | 495.21 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | ethyl (E)-6,6,6-trifluoro-3-methyl-2-tributylstannylhex-2-en-4-ynoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C(=O)OCC)=C(\C)C#CC(F)(F)F |
| InChI | InChI=1S/C9H8F3O2.3C4H9.Sn/c1-3-14-8(13)6-7(2)4-5-9(10,11)12;3*1-3-4-2;/h3H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | GWXHFFYFRRIWOJ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.21 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|