C30H45BrO2SSn — CID 134948772
ethyl (E)-5-(4-bromophenyl)-3-(5-methylthiophen-2-yl)-2-tributylstannylpent-2-enoate (PubChem CID 134948772) has the molecular formula C30H45BrO2SSn and a molecular weight of 668.37 g/mol. Its IUPAC name is ethyl (E)-5-(4-bromophenyl)-3-(5-methylthiophen-2-yl)-2-tributylstannylpent-2-enoate.
| Compound Name | ethyl (E)-5-(4-bromophenyl)-3-(5-methylthiophen-2-yl)-2-tributylstannylpent-2-enoate |
|---|---|
| PubChem CID | 134948772 |
| Molecular Formula | C30H45BrO2SSn |
| Molecular Weight | 668.37 g/mol |
| Exact Mass | 668.13 |
| IUPAC Name | ethyl (E)-5-(4-bromophenyl)-3-(5-methylthiophen-2-yl)-2-tributylstannylpent-2-enoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C(=O)OCC)=C(\CCc1ccc(Br)cc1)c1ccc(C)s1 |
| InChI | InChI=1S/C18H18BrO2S.3C4H9.Sn/c1-3-21-18(20)12-15(17-11-4-13(2)22-17)8-5-14-6-9-16(19)10-7-14;3*1-3-4-2;/h4,6-7,9-11H,3,5,8H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | FHUJLKWSXYGNJW-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.37 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|