C13H14BrNO2 — CID 162377131
ethyl 3-[2-(4-bromophenyl)ethyl]-2H-azirine-2-carboxylate (PubChem CID 162377131) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is ethyl 3-[2-(4-bromophenyl)ethyl]-2H-azirine-2-carboxylate.
| Compound Name | ethyl 3-[2-(4-bromophenyl)ethyl]-2H-azirine-2-carboxylate |
|---|---|
| PubChem CID | 162377131 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | ethyl 3-[2-(4-bromophenyl)ethyl]-2H-azirine-2-carboxylate |
| SMILES | CCOC(=O)C1N=C1CCc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrNO2/c1-2-17-13(16)12-11(15-12)8-5-9-3-6-10(14)7-4-9/h3-4,6-7,12H,2,5,8H2,1H3 |
| InChIKey | SIDMUXJTLHMZHH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |