C28H54O4Sn2-2 — CID 20836476
(E)-2,3-bis(tributylstannyl)but-2-enedioate (PubChem CID 20836476) has the molecular formula C28H54O4Sn2-2 and a molecular weight of 692.16 g/mol. Its IUPAC name is (E)-2,3-bis(tributylstannyl)but-2-enedioate.
| Compound Name | (E)-2,3-bis(tributylstannyl)but-2-enedioate |
|---|---|
| PubChem CID | 20836476 |
| Molecular Formula | C28H54O4Sn2-2 |
| Molecular Weight | 692.16 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | (E)-2,3-bis(tributylstannyl)but-2-enedioate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C(=O)[O-])=C(\C(=O)[O-])[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C4H2O4.6C4H9.2Sn/c5-3(6)1-2-4(7)8;6*1-3-4-2;;/h(H,5,6)(H,7,8);6*1,3-4H2,2H3;;/p-2 |
| InChIKey | RNGFPIYQVAIBKJ-UHFFFAOYSA-L |
| XLogP | 6.56 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.16 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|