About butyl(triethyl)azanium;2-methylprop-2-enoate
butyl(triethyl)azanium;2-methylprop-2-enoate (PubChem CID 139889730) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is butyl(triethyl)azanium;2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butyl(triethyl)azanium;2-methylprop-2-enoate |
| PubChem CID | 139889730 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | butyl(triethyl)azanium;2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)[O-].CCCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C10H24N.C4H6O2/c1-5-9-10-11(6-2,7-3)8-4;1-3(2)4(5)6/h5-10H2,1-4H3;1H2,2H3,(H,5,6)/q+1;/p-1 |
| InChIKey | REHYZNPUOIBJCV-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl(triethyl)azanium;2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(triethyl)azanium;2-methylprop-2-enoate?
The IUPAC name of butyl(triethyl)azanium;2-methylprop-2-enoate (CID 139889730) is butyl(triethyl)azanium;2-methylprop-2-enoate.
What is the SMILES notation for butyl(triethyl)azanium;2-methylprop-2-enoate?
The canonical SMILES for butyl(triethyl)azanium;2-methylprop-2-enoate is C=C(C)C(=O)[O-].CCCC[N+](CC)(CC)CC.
What is the InChIKey of butyl(triethyl)azanium;2-methylprop-2-enoate?
The InChIKey is REHYZNPUOIBJCV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H24N.C4H6O2/c1-5-9-10-11(6-2,7-3)8-4;1-3(2)4(5)6/h5-10H2,1-4H3;1H2,2H3,(H,5,6)/q+1;/p-1.
What are the key properties of butyl(triethyl)azanium;2-methylprop-2-enoate?
butyl(triethyl)azanium;2-methylprop-2-enoate has a molecular weight of 243.39 g/mol, XLogP of 1.98, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(triethyl)azanium;2-methylprop-2-enoate is sourced from PubChem (CID 139889730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).