About dibutyl(diethyl)azanium;titanium
dibutyl(diethyl)azanium;titanium (PubChem CID 175271824) has the molecular formula C12H28NTi+
and a molecular weight of 234.23 g/mol. Its IUPAC name is dibutyl(diethyl)azanium;titanium.
Molecular Properties
| Compound Name | dibutyl(diethyl)azanium;titanium |
| PubChem CID | 175271824 |
| Molecular Formula | C12H28NTi+ |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | dibutyl(diethyl)azanium;titanium |
| SMILES | CCCC[N+](CC)(CC)CCCC.[Ti] |
| InChI | InChI=1S/C12H28N.Ti/c1-5-9-11-13(7-3,8-4)12-10-6-2;/h5-12H2,1-4H3;/q+1; |
| InChIKey | XEIUNSFGMDIQSG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dibutyl(diethyl)azanium;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl(diethyl)azanium;titanium?
The IUPAC name of dibutyl(diethyl)azanium;titanium (CID 175271824) is dibutyl(diethyl)azanium;titanium.
What is the SMILES notation for dibutyl(diethyl)azanium;titanium?
The canonical SMILES for dibutyl(diethyl)azanium;titanium is CCCC[N+](CC)(CC)CCCC.[Ti].
What is the InChIKey of dibutyl(diethyl)azanium;titanium?
The InChIKey is XEIUNSFGMDIQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.Ti/c1-5-9-11-13(7-3,8-4)12-10-6-2;/h5-12H2,1-4H3;/q+1;.
What are the key properties of dibutyl(diethyl)azanium;titanium?
dibutyl(diethyl)azanium;titanium has a molecular weight of 234.23 g/mol, XLogP of 3.44, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(diethyl)azanium;titanium is sourced from PubChem (CID 175271824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).