About potassium;(E)-but-2-enedioate;tetrabutylazanium
potassium;(E)-but-2-enedioate;tetrabutylazanium (PubChem CID 87375823) has the molecular formula C20H38KNO4
and a molecular weight of 395.63 g/mol. Its IUPAC name is potassium;(E)-but-2-enedioate;tetrabutylazanium.
Molecular Properties
| Compound Name | potassium;(E)-but-2-enedioate;tetrabutylazanium |
| PubChem CID | 87375823 |
| Molecular Formula | C20H38KNO4 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | potassium;(E)-but-2-enedioate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])/C=C/C(=O)[O-].[K+] |
| InChI | InChI=1S/C16H36N.C4H4O4.K/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-3(6)1-2-4(7)8;/h5-16H2,1-4H3;1-2H,(H,5,6)(H,7,8);/q+1;;+1/p-2/b;2-1+; |
| InChIKey | WOOMMQKFCBDPGE-JITBQSAISA-L |
| XLogP | -0.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;(E)-but-2-enedioate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(E)-but-2-enedioate;tetrabutylazanium?
The IUPAC name of potassium;(E)-but-2-enedioate;tetrabutylazanium (CID 87375823) is potassium;(E)-but-2-enedioate;tetrabutylazanium.
What is the SMILES notation for potassium;(E)-but-2-enedioate;tetrabutylazanium?
The canonical SMILES for potassium;(E)-but-2-enedioate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])/C=C/C(=O)[O-].[K+].
What is the InChIKey of potassium;(E)-but-2-enedioate;tetrabutylazanium?
The InChIKey is WOOMMQKFCBDPGE-JITBQSAISA-L. The full InChI is InChI=1S/C16H36N.C4H4O4.K/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-3(6)1-2-4(7)8;/h5-16H2,1-4H3;1-2H,(H,5,6)(H,7,8);/q+1;;+1/p-2/b;2-1+;.
What are the key properties of potassium;(E)-but-2-enedioate;tetrabutylazanium?
potassium;(E)-but-2-enedioate;tetrabutylazanium has a molecular weight of 395.63 g/mol, XLogP of -0.95, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(E)-but-2-enedioate;tetrabutylazanium is sourced from PubChem (CID 87375823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).