About tetrabutylazanium;urea;bromide
tetrabutylazanium;urea;bromide (PubChem CID 158111645) has the molecular formula C17H40BrN3O
and a molecular weight of 382.43 g/mol. Its IUPAC name is tetrabutylazanium;urea;bromide.
Molecular Properties
| Compound Name | tetrabutylazanium;urea;bromide |
| PubChem CID | 158111645 |
| Molecular Formula | C17H40BrN3O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | tetrabutylazanium;urea;bromide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NC(N)=O.[Br-] |
| InChI | InChI=1S/C16H36N.CH4N2O.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3)4;/h5-16H2,1-4H3;(H4,2,3,4);1H/q+1;;/p-1 |
| InChIKey | FQMWYTJUVHPHKW-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;urea;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;urea;bromide?
The IUPAC name of tetrabutylazanium;urea;bromide (CID 158111645) is tetrabutylazanium;urea;bromide.
What is the SMILES notation for tetrabutylazanium;urea;bromide?
The canonical SMILES for tetrabutylazanium;urea;bromide is CCCC[N+](CCCC)(CCCC)CCCC.NC(N)=O.[Br-].
What is the InChIKey of tetrabutylazanium;urea;bromide?
The InChIKey is FQMWYTJUVHPHKW-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.CH4N2O.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3)4;/h5-16H2,1-4H3;(H4,2,3,4);1H/q+1;;/p-1.
What are the key properties of tetrabutylazanium;urea;bromide?
tetrabutylazanium;urea;bromide has a molecular weight of 382.43 g/mol, XLogP of 1.03, 12 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;urea;bromide is sourced from PubChem (CID 158111645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).