About ethanol;tetrabutylazanium;chloride
ethanol;tetrabutylazanium;chloride (PubChem CID 175552872) has the molecular formula C18H42ClNO
and a molecular weight of 323.99 g/mol. Its IUPAC name is ethanol;tetrabutylazanium;chloride.
Molecular Properties
| Compound Name | ethanol;tetrabutylazanium;chloride |
| PubChem CID | 175552872 |
| Molecular Formula | C18H42ClNO |
| Molecular Weight | 323.99 g/mol |
| Exact Mass | 323.30 |
| IUPAC Name | ethanol;tetrabutylazanium;chloride |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCO.[Cl-] |
| InChI | InChI=1S/C16H36N.C2H6O.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3;/h5-16H2,1-4H3;3H,2H2,1H3;1H/q+1;;/p-1 |
| InChIKey | MNNIVJFZOYBXJT-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.99 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethanol;tetrabutylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;tetrabutylazanium;chloride?
The IUPAC name of ethanol;tetrabutylazanium;chloride (CID 175552872) is ethanol;tetrabutylazanium;chloride.
What is the SMILES notation for ethanol;tetrabutylazanium;chloride?
The canonical SMILES for ethanol;tetrabutylazanium;chloride is CCCC[N+](CCCC)(CCCC)CCCC.CCO.[Cl-].
What is the InChIKey of ethanol;tetrabutylazanium;chloride?
The InChIKey is MNNIVJFZOYBXJT-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C2H6O.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3;/h5-16H2,1-4H3;3H,2H2,1H3;1H/q+1;;/p-1.
What are the key properties of ethanol;tetrabutylazanium;chloride?
ethanol;tetrabutylazanium;chloride has a molecular weight of 323.99 g/mol, XLogP of 2.01, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;tetrabutylazanium;chloride is sourced from PubChem (CID 175552872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).