About 2-methylprop-2-enoate;tributylsilanylium
2-methylprop-2-enoate;tributylsilanylium (PubChem CID 159425085) has the molecular formula C16H34O2Si
and a molecular weight of 286.53 g/mol. Its IUPAC name is 2-methylprop-2-enoate;tributylsilanylium.
Molecular Properties
| Compound Name | 2-methylprop-2-enoate;tributylsilanylium |
| PubChem CID | 159425085 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2-methylprop-2-enoate;tributylsilanylium |
| SMILES | C=C(C)C(=O)[O-].CCCC[SiH2+](CCCC)CCCC |
| InChI | InChI=1S/C12H29Si.C4H6O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3(2)4(5)6/h4-13H2,1-3H3;1H2,2H3,(H,5,6)/q+1;/p-1 |
| InChIKey | WUKVMQSNYJWAMV-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoate;tributylsilanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoate;tributylsilanylium?
The IUPAC name of 2-methylprop-2-enoate;tributylsilanylium (CID 159425085) is 2-methylprop-2-enoate;tributylsilanylium.
What is the SMILES notation for 2-methylprop-2-enoate;tributylsilanylium?
The canonical SMILES for 2-methylprop-2-enoate;tributylsilanylium is C=C(C)C(=O)[O-].CCCC[SiH2+](CCCC)CCCC.
What is the InChIKey of 2-methylprop-2-enoate;tributylsilanylium?
The InChIKey is WUKVMQSNYJWAMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H29Si.C4H6O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3(2)4(5)6/h4-13H2,1-3H3;1H2,2H3,(H,5,6)/q+1;/p-1.
What are the key properties of 2-methylprop-2-enoate;tributylsilanylium?
2-methylprop-2-enoate;tributylsilanylium has a molecular weight of 286.53 g/mol, XLogP of 3.66, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoate;tributylsilanylium is sourced from PubChem (CID 159425085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).