C28H60O2Sn2 — CID 11082898
(Z)-2,3-bis(tributylstannyl)but-2-ene-1,4-diol (PubChem CID 11082898) has the molecular formula C28H60O2Sn2 and a molecular weight of 666.21 g/mol. Its IUPAC name is (Z)-2,3-bis(tributylstannyl)but-2-ene-1,4-diol.
| Compound Name | (Z)-2,3-bis(tributylstannyl)but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 11082898 |
| Molecular Formula | C28H60O2Sn2 |
| Molecular Weight | 666.21 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | (Z)-2,3-bis(tributylstannyl)but-2-ene-1,4-diol |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(CO)=C(/CO)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C4H6O2.6C4H9.2Sn/c5-3-1-2-4-6;6*1-3-4-2;;/h5-6H,3-4H2;6*1,3-4H2,2H3;; |
| InChIKey | NHDAGZLPPHNLOW-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.21 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |