C21H42OSn — CID 154232279
(4E)-2-tributylstannylnona-2,4-dien-1-ol (PubChem CID 154232279) has the molecular formula C21H42OSn and a molecular weight of 429.28 g/mol. Its IUPAC name is (4E)-2-tributylstannylnona-2,4-dien-1-ol.
| Compound Name | (4E)-2-tributylstannylnona-2,4-dien-1-ol |
|---|---|
| PubChem CID | 154232279 |
| Molecular Formula | C21H42OSn |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (4E)-2-tributylstannylnona-2,4-dien-1-ol |
| SMILES | CCCC/C=C/C=C(CO)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H15O.3C4H9.Sn/c1-2-3-4-5-6-7-8-9-10;3*1-3-4-2;/h5-7,10H,2-4,9H2,1H3;3*1,3-4H2,2H3;/b6-5+,8-7?;;;; |
| InChIKey | AWRJQBWBMFGDRO-XXXPIDQRSA-N |
| XLogP | 7.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|