C12H20O — CID 87210955
(2E,4E)-2-prop-2-enoxynona-2,4-diene (PubChem CID 87210955) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E,4E)-2-prop-2-enoxynona-2,4-diene.
| Compound Name | (2E,4E)-2-prop-2-enoxynona-2,4-diene |
|---|---|
| PubChem CID | 87210955 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2E,4E)-2-prop-2-enoxynona-2,4-diene |
| SMILES | C=CCO/C(C)=C/C=C/CCCC |
| InChI | InChI=1S/C12H20O/c1-4-6-7-8-9-10-12(3)13-11-5-2/h5,8-10H,2,4,6-7,11H2,1,3H3/b9-8+,12-10+ |
| InChIKey | SHCNXHIGFCWVDO-CDKJVOIVSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|