C7H10O3S — CID 142823719
(3E,5Z)-hepta-1,3,5-triene-3-sulfonic acid (PubChem CID 142823719) has the molecular formula C7H10O3S and a molecular weight of 174.22 g/mol. Its IUPAC name is (3E,5Z)-hepta-1,3,5-triene-3-sulfonic acid.
| Compound Name | (3E,5Z)-hepta-1,3,5-triene-3-sulfonic acid |
|---|---|
| PubChem CID | 142823719 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | (3E,5Z)-hepta-1,3,5-triene-3-sulfonic acid |
| SMILES | C=C/C(=C\C=C/C)S(=O)(=O)O |
| InChI | InChI=1S/C7H10O3S/c1-3-5-6-7(4-2)11(8,9)10/h3-6H,2H2,1H3,(H,8,9,10)/b5-3-,7-6+ |
| InChIKey | GPUOHQYEWVKBMF-AIJKMKQJSA-N |
| XLogP | 1.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|