C14H16O2S — CID 138646292
(3E,5Z)-3-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylocta-1,3,5,7-tetraene (PubChem CID 138646292) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is (3E,5Z)-3-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylocta-1,3,5,7-tetraene.
| Compound Name | (3E,5Z)-3-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 138646292 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (3E,5Z)-3-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C=C(/C=C)S(=O)(=O)/C(C=C)=C/C=C |
| InChI | InChI=1S/C14H16O2S/c1-5-9-10-12-14(8-4)17(15,16)13(7-3)11-6-2/h5-12H,1-4H2/b10-9-,13-11+,14-12+ |
| InChIKey | QWSVQGHOEKKDMZ-ACHNQTNHSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|