C14H14O2S — CID 134299911
[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]sulfonylbenzene (PubChem CID 134299911) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is [(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]sulfonylbenzene.
| Compound Name | [(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 134299911 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]sulfonylbenzene |
| SMILES | C=C/C=C\C=C(/C=C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14O2S/c1-3-5-7-10-13(4-2)17(15,16)14-11-8-6-9-12-14/h3-12H,1-2H2/b7-5-,13-10+ |
| InChIKey | QCFYPGBSBJUYMZ-PBHGGESISA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|