C15H23NO2S — CID 175107138
N-ethylethanamine;penta-2,4-dien-2-ylsulfonylbenzene (PubChem CID 175107138) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-ethylethanamine;penta-2,4-dien-2-ylsulfonylbenzene.
| Compound Name | N-ethylethanamine;penta-2,4-dien-2-ylsulfonylbenzene |
|---|---|
| PubChem CID | 175107138 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-ethylethanamine;penta-2,4-dien-2-ylsulfonylbenzene |
| SMILES | C=CC=C(C)S(=O)(=O)c1ccccc1.CCNCC |
| InChI | InChI=1S/C11H12O2S.C4H11N/c1-3-7-10(2)14(12,13)11-8-5-4-6-9-11;1-3-5-4-2/h3-9H,1H2,2H3;5H,3-4H2,1-2H3 |
| InChIKey | IOHLGEJNNROCPN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|