C20H22O2S — CID 10042067
[(3E)-3-(benzenesulfonyl)-6-methylhepta-3,5-dienyl]benzene (PubChem CID 10042067) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is [(3E)-3-(benzenesulfonyl)-6-methylhepta-3,5-dienyl]benzene.
| Compound Name | [(3E)-3-(benzenesulfonyl)-6-methylhepta-3,5-dienyl]benzene |
|---|---|
| PubChem CID | 10042067 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(3E)-3-(benzenesulfonyl)-6-methylhepta-3,5-dienyl]benzene |
| SMILES | CC(C)=C/C=C(\CCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O2S/c1-17(2)13-15-20(16-14-18-9-5-3-6-10-18)23(21,22)19-11-7-4-8-12-19/h3-13,15H,14,16H2,1-2H3/b20-15+ |
| InChIKey | JABAMNCIFCHAII-HMMYKYKNSA-N |
| XLogP | 4.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|