C14H16O — CID 158943727
(2E)-5-methyl-7-phenylhepta-2,4-dienal (PubChem CID 158943727) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (2E)-5-methyl-7-phenylhepta-2,4-dienal.
| Compound Name | (2E)-5-methyl-7-phenylhepta-2,4-dienal |
|---|---|
| PubChem CID | 158943727 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2E)-5-methyl-7-phenylhepta-2,4-dienal |
| SMILES | CC(=C/C=C/C=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H16O/c1-13(7-5-6-12-15)10-11-14-8-3-2-4-9-14/h2-9,12H,10-11H2,1H3/b6-5+,13-7? |
| InChIKey | POQWMTBBBBJTRZ-HNIQKQMJSA-N |
| XLogP | 3.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|