C11H10O4S — CID 90286525
(2Z)-2-(benzenesulfonyl)penta-2,4-dienoic acid (PubChem CID 90286525) has the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. Its IUPAC name is (2Z)-2-(benzenesulfonyl)penta-2,4-dienoic acid.
| Compound Name | (2Z)-2-(benzenesulfonyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90286525 |
| Molecular Formula | C11H10O4S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (2Z)-2-(benzenesulfonyl)penta-2,4-dienoic acid |
| SMILES | C=C/C=C(/C(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H10O4S/c1-2-6-10(11(12)13)16(14,15)9-7-4-3-5-8-9/h2-8H,1H2,(H,12,13)/b10-6- |
| InChIKey | MWUGAKSEXJQRLD-POHAHGRESA-N |
| XLogP | 1.61 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|