C12H12FNO4S2 — CID 145127504
N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylbenzenesulfonamide (PubChem CID 145127504) has the molecular formula C12H12FNO4S2 and a molecular weight of 317.36 g/mol. Its IUPAC name is N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylbenzenesulfonamide.
| Compound Name | N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 145127504 |
| Molecular Formula | C12H12FNO4S2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylbenzenesulfonamide |
| SMILES | C=C/C=C(\C=C)S(=O)(=O)N(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12FNO4S2/c1-3-8-11(4-2)19(15,16)14(13)20(17,18)12-9-6-5-7-10-12/h3-10H,1-2H2/b11-8+ |
| InChIKey | SIJOLUAWEUNTHF-DHZHZOJOSA-N |
| XLogP | 2.15 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|