C14H25NO2S — CID 143725209
ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]sulfonyl-3-methylpiperidine (PubChem CID 143725209) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]sulfonyl-3-methylpiperidine.
| Compound Name | ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 143725209 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]sulfonyl-3-methylpiperidine |
| SMILES | C=C/C=C(\C=C)S(=O)(=O)N1CCCC(C)C1.CC |
| InChI | InChI=1S/C12H19NO2S.C2H6/c1-4-7-12(5-2)16(14,15)13-9-6-8-11(3)10-13;1-2/h4-5,7,11H,1-2,6,8-10H2,3H3;1-2H3/b12-7+; |
| InChIKey | JIVIFPDQKIVJFR-RRAJOLSVSA-N |
| XLogP | 3.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|