C11H20N2O2S — CID 143369575
(3R)-N,N-dimethyl-1-[(3E)-penta-1,3-dien-3-yl]sulfonylpyrrolidin-3-amine (PubChem CID 143369575) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-1-[(3E)-penta-1,3-dien-3-yl]sulfonylpyrrolidin-3-amine.
| Compound Name | (3R)-N,N-dimethyl-1-[(3E)-penta-1,3-dien-3-yl]sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 143369575 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (3R)-N,N-dimethyl-1-[(3E)-penta-1,3-dien-3-yl]sulfonylpyrrolidin-3-amine |
| SMILES | C=C/C(=C\C)S(=O)(=O)N1CC[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C11H20N2O2S/c1-5-11(6-2)16(14,15)13-8-7-10(9-13)12(3)4/h5-6,10H,1,7-9H2,2-4H3/b11-6+/t10-/m1/s1 |
| InChIKey | JBSMHMWPWYOYAH-VUUNSECVSA-N |
| XLogP | 1.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|