C11H23NO3S — CID 176706774
ethane;(3R)-1-(1-methoxyethenylsulfonyl)-3-methylpiperidine (PubChem CID 176706774) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is ethane;(3R)-1-(1-methoxyethenylsulfonyl)-3-methylpiperidine.
| Compound Name | ethane;(3R)-1-(1-methoxyethenylsulfonyl)-3-methylpiperidine |
|---|---|
| PubChem CID | 176706774 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethane;(3R)-1-(1-methoxyethenylsulfonyl)-3-methylpiperidine |
| SMILES | C=C(OC)S(=O)(=O)N1CCC[C@@H](C)C1.CC |
| InChI | InChI=1S/C9H17NO3S.C2H6/c1-8-5-4-6-10(7-8)14(11,12)9(2)13-3;1-2/h8H,2,4-7H2,1,3H3;1-2H3/t8-;/m1./s1 |
| InChIKey | XKKJJVXTAUXKQK-DDWIOCJRSA-N |
| XLogP | 2.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|